CymitQuimica logo

CAS 1254163-84-2

:

1-(1,1-Dimethylethyl) 4-(5-borono-4-methyl-2-pyridinyl)-1-piperazinecarboxylate

Description:
1-(1,1-Dimethylethyl) 4-(5-borono-4-methyl-2-pyridinyl)-1-piperazinecarboxylate, with CAS number 1254163-84-2, is a chemical compound characterized by its complex structure, which includes a piperazine ring, a boron-containing group, and a pyridine moiety. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with biological targets. The boron atom in the structure may play a significant role in coordination chemistry and could be involved in various chemical reactions, including those relevant to medicinal chemistry. This compound may exhibit properties such as solubility in organic solvents, and its functional groups suggest potential applications in drug development, particularly in targeting specific biological pathways. The presence of the piperazine ring often indicates pharmacological activity, making this compound of interest in the field of medicinal chemistry and drug design. Further studies would be necessary to elucidate its specific biological activities and potential therapeutic applications.
Formula:C15H24BN3O4
InChI:InChI=1S/C15H24BN3O4/c1-11-9-13(17-10-12(11)16(21)22)18-5-7-19(8-6-18)14(20)23-15(2,3)4/h9-10,21-22H,5-8H2,1-4H3
InChI key:InChIKey=GBQHGDQAFMZCRV-UHFFFAOYSA-N
SMILES:CC=1C=C(N2CCN(C(OC(C)(C)C)=O)CC2)N=CC1B(O)O
Synonyms:
  • 1-Piperazinecarboxylic acid, 4-(5-borono-4-methyl-2-pyridinyl)-, 1-(1,1-dimethylethyl) ester
  • 1-(1,1-Dimethylethyl) 4-(5-borono-4-methyl-2-pyridinyl)-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.