
CAS 1254172-26-3
:(αS,2R)-α-Aminotetrahydro-2-furanpropanoic acid
Description:
(αS,2R)-α-Aminotetrahydro-2-furanpropanoic acid is a chiral amino acid derivative characterized by its unique structural features, including a tetrahydrofuran ring and an amino group. This compound is notable for its potential applications in medicinal chemistry and as a building block in the synthesis of biologically active molecules. The presence of the furan ring contributes to its distinct reactivity and solubility properties, making it an interesting candidate for various chemical reactions. Its chirality, indicated by the specific stereochemical descriptors (αS,2R), suggests that it may exhibit different biological activities compared to its enantiomers. This compound is typically studied in the context of drug design and development, where its ability to interact with biological targets can be explored. Additionally, its stability and compatibility with other functional groups are important considerations in synthetic pathways. Overall, (αS,2R)-α-Aminotetrahydro-2-furanpropanoic acid represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c8-6(7(9)10)4-5-2-1-3-11-5/h5-6H,1-4,8H2,(H,9,10)/t5-,6+/m1/s1
InChI key:InChIKey=IMSUDXBVOIOXLR-RITPCOANSA-N
SMILES:C([C@@H](C(O)=O)N)[C@H]1CCCO1
Synonyms:- (αS,2R)-α-Aminotetrahydro-2-furanpropanoic acid
- 2-Furanpropanoic acid, α-aminotetrahydro-, (αS,2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.