
CAS 1254177-54-2
:4-Bromo-α-(4-nitrophenyl)benzenepropanenitrile
Description:
4-Bromo-α-(4-nitrophenyl)benzenepropanenitrile is an organic compound characterized by its complex structure, which includes a bromine atom, a nitrophenyl group, and a nitrile functional group. The presence of the bromine atom introduces significant electrophilic properties, while the nitro group contributes to the compound's overall electron-withdrawing characteristics, influencing its reactivity and stability. The nitrile functional group (-C≡N) is known for its polar nature and ability to participate in various chemical reactions, such as nucleophilic additions. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its aromatic components. Its synthesis may involve multi-step reactions typical of organic synthesis, including halogenation and nitration processes. The compound's potential applications could span across pharmaceuticals, agrochemicals, or materials science, particularly in the development of novel compounds with specific electronic or optical properties. As with many organic compounds, safety precautions should be observed due to potential toxicity or environmental impact.
Formula:C15H11BrN2O2
InChI:InChI=1S/C15H11BrN2O2/c16-14-5-1-11(2-6-14)9-13(10-17)12-3-7-15(8-4-12)18(19)20/h1-8,13H,9H2
InChI key:InChIKey=BYAJHKOQJNOERC-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Br)C=C1)(C#N)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 4-Bromo-α-(4-nitrophenyl)benzenepropanenitrile
- Benzenepropanenitrile, 4-bromo-α-(4-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
