CAS 125418-84-0

Benzaldehyde, 2-[2-(4-morpholinyl)-2-oxoethoxy]-

Description:

Benzaldehyde, 2-[2-(4-morpholinyl)-2-oxoethoxy]- is a chemical compound characterized by its structure, which includes a benzaldehyde moiety and a morpholine ring. This compound features a morpholinyl group, which is a six-membered heterocyclic ring containing both oxygen and nitrogen atoms, contributing to its potential biological activity. The presence of the ethoxy group linked to the carbonyl functionality enhances its reactivity and solubility in organic solvents. Typically, compounds like this may exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals due to the morpholine component, which is often associated with various biological activities. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as boiling point and solubility. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled.

Formula: C₁₃H₁₅NO₄

InChI: InChI=1S/C13H15NO4/c15-9-11-3-1-2-4-12(11)18-10-13(16)14-5-7-17-8-6-14/h1-4,9H,5-8,10H2

InChI key: InChIKey=YZMAOODEXODERH-UHFFFAOYSA-N

SMILES: O(CC(=O)N1CCOCC1)C2=C(C=O)C=CC=C2

Synonyms:

• 2-[2-(Morpholin-4-yl)-2-oxoethoxy]benzaldehyde
• 2-(2-Morpholin-4-yl-2-oxoethoxy)benzaldehyde
• Morpholine, 4-[(2-formylphenoxy)acetyl]-
• Benzaldehyde, 2-[2-(4-morpholinyl)-2-oxoethoxy]-