CAS 125418-89-5

2-(2-oxo-2-piperidin-1-ylethoxy)benzaldehyde

Description:

2-(2-oxo-2-piperidin-1-ylethoxy)benzaldehyde, with the CAS number 125418-89-5, is an organic compound characterized by its unique structure that combines a benzaldehyde moiety with a piperidine-derived functional group. This compound features a piperidine ring that is substituted with an ethoxy group and a carbonyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability in different solvents can vary, influencing its practical applications. Overall, 2-(2-oxo-2-piperidin-1-ylethoxy)benzaldehyde is a versatile compound that can serve as a building block in the synthesis of more complex organic molecules.

Formula: C₁₄H₁₇NO₃

InChI: InChI=1/C14H17NO3/c16-10-12-6-2-3-7-13(12)18-11-14(17)15-8-4-1-5-9-15/h2-3,6-7,10H,1,4-5,8-9,11H2

SMILES: C1CCN(CC1)C(=O)COc1ccccc1C=O

2-(2-Oxo-2-(piperidin-1-yl)ethoxy)benzaldehyde

CAS: 125418-89-5

Formula: C₁₄H₁₇NO₃

Molecular weight: 247.2897

Ref: IN-DA000NOK

2-[2-oxo-2-(1-piperidinyl)ethoxy]benzaldehyde

CAS: 125418-89-5

Formula: C₁₄H₁₇NO₃

Purity: 95.0%

Molecular weight: 247.294

Ref: 10-F316237