CymitQuimica logo

CAS 125419-93-4

:

3-Bromo-4-propylpyridine

Description:
3-Bromo-4-propylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 3-position and a propyl group at the 4-position of the pyridine ring defines its structure and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the bromine substituent, which can participate in nucleophilic substitution reactions. Additionally, the propyl group can influence the compound's solubility and lipophilicity, affecting its biological activity. As with many halogenated compounds, appropriate safety measures should be taken when handling 3-Bromo-4-propylpyridine, as it may pose health risks and environmental concerns.
Formula:C8H10BrN
InChI:InChI=1S/C8H10BrN/c1-2-3-7-4-5-10-6-8(7)9/h4-6H,2-3H2,1H3
InChI key:InChIKey=PPXNTHZLYOJZCA-UHFFFAOYSA-N
SMILES:C(CC)C=1C(Br)=CN=CC1
Synonyms:
  • 3-Bromo-4-propylpyridine
  • Pyridine, 3-bromo-4-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.