CAS 1254196-54-7

1-Bromo-4-chloro-7,8-difluoroimidazo[1,2-a]quinoxaline

Description:

1-Bromo-4-chloro-7,8-difluoroimidazo[1,2-a]quinoxaline is a heterocyclic compound characterized by its complex structure, which includes both halogen substituents and a fused imidazoquinoxaline framework. This compound features a bromine atom at the 1-position, a chlorine atom at the 4-position, and two fluorine atoms at the 7 and 8 positions of the imidazoquinoxaline ring system. The presence of these halogens can significantly influence the compound's chemical reactivity, solubility, and potential biological activity. Typically, such compounds are of interest in medicinal chemistry due to their potential as pharmacological agents, particularly in targeting specific biological pathways. The imidazoquinoxaline core is known for its ability to interact with various biological targets, making it a subject of research in drug development. Additionally, the compound's unique electronic properties, derived from the halogen substituents, may enhance its interactions with proteins or nucleic acids, further expanding its potential applications in therapeutic contexts.

Formula: C₁₀H₃BrClF₂N₃

InChI: InChI=1S/C10H3BrClF2N3/c11-8-3-15-10-9(12)16-6-1-4(13)5(14)2-7(6)17(8)10/h1-3H

InChI key: InChIKey=BIWVNFGXRUWGFH-UHFFFAOYSA-N

SMILES: BrC=1N2C=3C(N=C(Cl)C2=NC1)=CC(F)=C(F)C3

Synonyms:

• 1-Bromo-4-chloro-7,8-difluoroimidazo[1,2-a]quinoxaline
• Imidazo[1,2-a]quinoxaline, 1-bromo-4-chloro-7,8-difluoro-