CAS 12542-30-2
:Dihydrodicyclopentadienyl acrylate
Description:
Dihydrodicyclopentadienyl acrylate, with the CAS number 12542-30-2, is an organic compound characterized by its acrylate functional group, which is known for its reactivity in polymerization processes. This substance features a bicyclic structure derived from dicyclopentadiene, contributing to its unique physical and chemical properties. It is typically a colorless to pale yellow liquid with a moderate viscosity. The presence of the acrylate group allows it to undergo free radical polymerization, making it useful in the production of various polymers and copolymers. Dihydrodicyclopentadienyl acrylate is often employed in coatings, adhesives, and sealants due to its ability to enhance mechanical properties and improve adhesion. Additionally, it exhibits good thermal stability and resistance to environmental factors, which is advantageous in industrial applications. Safety considerations include handling it with care, as it may cause skin and eye irritation. Overall, this compound is valued for its versatility in material science and polymer chemistry.
Formula:C13H16O2
InChI:InChI=1/C13H16O2/c1-2-12(14)15-11-6-5-10-8-3-4-9(7-8)13(10)11/h2,5-6,8-11,13H,1,3-4,7H2
SMILES:C=CC(=O)OC1C=CC2C3CCC(C3)C12
Synonyms:- 2-Propenoic acid, 3a,4,7,7a,?,?-hexahydro-4,7-methano-1H-indenyl ester
- Hexahydro-4,7-methano-1H-indenyl acrylate
- 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-1-yl prop-2-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.