CymitQuimica logo

CAS 125428-11-7

:

(E)-1-(2-bromovinyl)-4-chlorobenzene

Description:
(E)-1-(2-bromovinyl)-4-chlorobenzene is an organic compound characterized by its unique structure, which includes a vinyl group attached to a bromine atom and a chlorobenzene moiety. This compound features a trans configuration (denoted by the (E) designation) around the double bond, indicating that the highest priority substituents on either end of the double bond are on opposite sides. It is a halogenated aromatic compound, which typically exhibits properties such as moderate to low solubility in water, but good solubility in organic solvents like ethanol and dichloromethane. The presence of bromine and chlorine atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, due to the halogen substituents, it may exhibit interesting electronic properties, influencing its behavior in both chemical reactions and potential applications in materials science or pharmaceuticals. Safety precautions should be taken when handling this compound, as halogenated compounds can be toxic and environmentally hazardous.
Formula:C8H6BrCl
InChI:InChI=1/C8H6BrCl/c9-6-5-7-1-3-8(10)4-2-7/h1-6H
SMILES:c1cc(ccc1C=CBr)Cl
Synonyms:
  • 1-(2-Bromoethenyl)-4-Chlorobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.