CAS 1254319-63-5

1,2-Benzisothiazole, 5-bromo-2,3-dihydro-2-methyl-, 1,1-dioxide

Description:

1,2-Benzisothiazole, 5-bromo-2,3-dihydro-2-methyl-, 1,1-dioxide, identified by CAS number 1254319-63-5, is a heterocyclic compound featuring a benzothiazole core. This compound is characterized by the presence of a bromine atom at the 5-position and a methyl group at the 2-position of the dihydrobenzothiazole structure. The "1,1-dioxide" designation indicates the presence of two oxygen atoms bonded to the sulfur atom in the thiazole ring, enhancing its reactivity and solubility in various solvents. Typically, compounds of this class exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. They may also possess properties such as antimicrobial or antifungal activity, although specific biological effects would depend on the compound's structure and substituents. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups, making it a subject of interest for further study in synthetic and medicinal chemistry.

Formula: C₈H₈BrNO₂S

InChI: InChI=1S/C8H8BrNO2S/c1-10-5-6-4-7(9)2-3-8(6)13(10,11)12/h2-4H,5H2,1H3

InChI key: InChIKey=VAZHOIQKQXQESB-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(CN1C)=CC(Br)=CC2

Synonyms:

• 5-Bromo-2-methyl-2,3-dihydro-1,2-benzisothiazole 1,1-dioxide
• 1,2-Benzisothiazole, 5-bromo-2,3-dihydro-2-methyl-, 1,1-dioxide