CAS 1254353-37-1: 5,6-Bis(octyloxy)-2,1,3-benzothiadiazole
Description:5,6-Bis(octyloxy)-2,1,3-benzothiadiazole is an organic compound characterized by its unique structure, which includes a benzothiadiazole core substituted with two octyloxy groups. This compound typically exhibits properties such as good solubility in organic solvents due to the long hydrophobic octyloxy chains, making it suitable for applications in organic electronics, particularly in organic photovoltaics and light-emitting diodes. The presence of the benzothiadiazole moiety contributes to its electronic properties, including potential for strong light absorption and charge transport capabilities. Additionally, the compound may display interesting photophysical properties, such as fluorescence, which can be advantageous in various optoelectronic applications. Its stability and performance in devices can be influenced by factors such as molecular packing and interactions with other materials. Overall, 5,6-Bis(octyloxy)-2,1,3-benzothiadiazole represents a class of materials that are being explored for their potential in advanced electronic applications.
Formula:C22H36N2O2S
InChI:InChI=1S/C22H36N2O2S/c1-3-5-7-9-11-13-15-25-21-17-19-20(24-27-23-19)18-22(21)26-16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5,6-Bis(n-octyloxy)-2,1,3-benzothiadiazole REF: 3B-B4440CAS: 1254353-37-1 | >98.0%(GC) | 144.00 € | Tue 08 Apr 25 |
![]() | 2,1,3-Benzothiadiazole, 5,6-bis(octyloxy)- REF: IN-DA000NOTCAS: 1254353-37-1 | 98% | 66.00 €~103.00 € | Tue 15 Apr 25 |
![]() | 5,6-Bis(n-octyloxy)-2,1,3-benzothiadiazole REF: 3D-EAC35337CAS: 1254353-37-1 | Min. 95% | - - - | Discontinued product |

5,6-Bis(n-octyloxy)-2,1,3-benzothiadiazole
Ref: 3B-B4440
200mg | 144.00 € |

2,1,3-Benzothiadiazole, 5,6-bis(octyloxy)-
Ref: IN-DA000NOT
100mg | 66.00 € | ||
250mg | 103.00 € |

5,6-Bis(n-octyloxy)-2,1,3-benzothiadiazole
Ref: 3D-EAC35337
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |