CAS 125440-92-8

7-(α-D-Mannopyranosyloxy)-3H-phenoxazin-3-one

Description:

7-(α-D-Mannopyranosyloxy)-3H-phenoxazin-3-one, with the CAS number 125440-92-8, is a chemical compound characterized by its phenoxazine core, which is a tricyclic structure known for its chromophoric properties. The presence of the α-D-mannopyranosyl group indicates that this compound is a glycoside, suggesting it may exhibit biological activity, potentially influencing solubility and reactivity. The phenoxazine moiety is often associated with applications in dyes, fluorescence, and as a redox-active agent. This compound may also possess antioxidant properties due to the phenolic structure, which can donate electrons. Its solubility and stability can be affected by the glycosylation, which typically enhances water solubility compared to its aglycone counterparts. Overall, this compound's unique structural features may contribute to its potential utility in biochemical applications, including as a probe in biological systems or as a component in drug development. Further studies would be necessary to elucidate its specific properties and potential applications in various fields.

Formula: C₁₈H₁₇NO₈

InChI: InChI=1S/C18H17NO8/c20-7-14-15(22)16(23)17(24)18(27-14)25-9-2-4-11-13(6-9)26-12-5-8(21)1-3-10(12)19-11/h1-6,14-18,20,22-24H,7H2/t14-,15-,16+,17+,18+/m1/s1

InChI key: InChIKey=QULZFZMEBOATFS-ZBRFXRBCSA-N

SMILES: O(C=1C=C2C(N=C3C(O2)=CC(=O)C=C3)=CC1)[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O

Synonyms:

• 3H-Phenoxazin-3-one, 7-(α-D-mannopyranosyloxy)-
• 7-(α-D-Mannopyranosyloxy)-3H-phenoxazin-3-one

Resorufin a-D-mannopyranoside

CAS: 125440-92-8

Resorufin alpha-D-glucopyranoside is a sensitive fluorogenic substrate that generates a red fluorescent product (resorufin) upon interaction with alpha-glucosidase.

Purity: Min. 95%

Color and Shape: Brown Powder

Molecular weight: 375.33 g/mol

Ref: 3D-ER58675