CAS 1254473-74-9

5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1H-indazole

Description:

5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1H-indazole, with the CAS number 1254473-74-9, is a chemical compound characterized by its unique structural features, which include an indazole core and a silyl ether functional group. The presence of the dimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various chemical applications. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic and hydrophilic regions in its structure. Additionally, the tert-butyl group contributes to steric hindrance, which can influence its reactivity and interactions with other molecules. The indazole moiety is known for its biological activity, potentially making this compound of interest in medicinal chemistry. Overall, its distinctive features suggest potential utility in synthetic organic chemistry and possibly in pharmaceutical development, although specific applications would depend on further research into its properties and behavior in various environments.

Formula: C₁₃H₂₀N₂OSi

InChI: InChI=1S/C13H20N2OSi/c1-13(2,3)17(4,5)16-11-6-7-12-10(8-11)9-14-15-12/h6-9H,1-5H3,(H,14,15)

InChI key: InChIKey=TYQUQRGGXWJRAR-UHFFFAOYSA-N

SMILES: O([Si](C(C)(C)C)(C)C)C=1C=C2C(=CC1)NN=C2

Synonyms:

• 5-(tert-Butyl-dimethyl-silanyloxy)-1H-indazole
• 5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1H-indazole
• 5-[(tert-Butyldimethylsilyl)oxy]-1H-indazole
• 1H-Indazole, 5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-