CAS 125464-42-8: Saclofen
Description:Saclofen is a chemical compound classified as a selective antagonist of the GABA_B receptor, which plays a crucial role in the central nervous system. It is primarily used in research settings to investigate the physiological and pharmacological effects of GABA_B receptor modulation. Saclofen is known for its ability to inhibit the action of GABA, a major inhibitory neurotransmitter, thereby influencing various neurological processes. The compound is typically characterized by its solubility in water and organic solvents, making it suitable for various experimental applications. Its molecular structure includes a sulfonic acid group, contributing to its unique properties and interactions within biological systems. Saclofen has been studied for its potential therapeutic effects in conditions such as spasticity and pain management, although its clinical use is limited. Safety and handling precautions are essential when working with this compound, as with any chemical substance, to mitigate potential risks associated with its pharmacological activity.
Formula:C9H12ClNO3S
InChI:InChI=1S/C9H12ClNO3S/c10-9-3-1-7(2-4-9)8(5-11)6-15(12,13)14/h1-4,8H,5-6,11H2,(H,12,13,14)
InChI key:InChIKey=JYLNVJYYQQXNEK-UHFFFAOYSA-N
SMILES:O=S(=O)(O)CC(C1=CC=C(Cl)C=C1)CN
- Synonyms:
- (RS)-3-amino-2-(4-chlorophenyl)propylsulfonic acid
- 3-Amino-2-(4-chlorophenyl)propane-1-sulfonic acid
- Benzeneethanesulfonic acid, β-(aminomethyl)-4-chloro-
- β-(Aminomethyl)-4-chlorobenzeneethanesulfonic acid
- Saclofen
