CymitQuimica logo

CAS 1254710-18-3

:

8-Bromo-7-chloro-2-(2-chlorophenyl)[1,2,4]triazolo[1,5-c]pyrimidine

Description:
8-Bromo-7-chloro-2-(2-chlorophenyl)[1,2,4]triazolo[1,5-c]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyrimidine moiety. This compound features multiple halogen substituents, specifically bromine and chlorine, which can significantly influence its chemical reactivity and biological activity. The presence of the chlorophenyl group enhances its lipophilicity, potentially affecting its solubility and interaction with biological targets. The triazolo and pyrimidine rings contribute to its aromaticity and stability, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structure may also impart specific pharmacological properties, such as antimicrobial or anticancer activities, although detailed studies would be necessary to elucidate these effects. Overall, 8-Bromo-7-chloro-2-(2-chlorophenyl)[1,2,4]triazolo[1,5-c]pyrimidine represents a class of compounds that are of interest for their potential therapeutic applications and as tools in chemical biology.
Formula:C11H5BrCl2N4
InChI:InChI=1S/C11H5BrCl2N4/c12-8-9(14)15-5-18-11(8)16-10(17-18)6-3-1-2-4-7(6)13/h1-5H
InChI key:InChIKey=WXIGFOWNEAASSR-UHFFFAOYSA-N
SMILES:ClC1=C(C=2N=C3N(N2)C=NC(Cl)=C3Br)C=CC=C1
Synonyms:
  • [1,2,4]Triazolo[1,5-c]pyrimidine, 8-bromo-7-chloro-2-(2-chlorophenyl)-
  • 8-Bromo-7-chloro-2-(2-chlorophenyl)[1,2,4]triazolo[1,5-c]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.