CAS 125472-02-8
:Mivazerol
Description:
Mivazerol, with the CAS number 125472-02-8, is a chemical compound that belongs to the class of imidazoline derivatives. It is primarily recognized for its pharmacological properties, particularly as a selective alpha-2 adrenergic receptor agonist. This characteristic allows Mivazerol to influence neurotransmitter release, which can have implications in various therapeutic areas, including cardiovascular and central nervous system disorders. The compound is typically administered in specific formulations and is studied for its potential effects on blood pressure regulation and sedation. Mivazerol's mechanism of action involves binding to alpha-2 adrenergic receptors, leading to a decrease in sympathetic outflow and modulation of neurotransmitter release. Its safety profile and efficacy are evaluated through clinical studies, and it is essential to consider its pharmacokinetics, potential side effects, and interactions with other medications when assessing its therapeutic use. As with any pharmaceutical agent, ongoing research continues to explore its full range of applications and benefits in medical practice.
Formula:C11H11N3O2
InChI:InChI=1/C11H11N3O2/c12-11(16)9-3-1-2-7(10(9)15)4-8-5-13-6-14-8/h1-3,5-6,15H,4H2,(H2,12,16)(H,13,14)
InChI key:InChIKey=RLHGFJMGWQXPBW-UHFFFAOYSA-N
SMILES:C(C1=C(O)C(C(N)=O)=CC=C1)C2=CN=CN2
Synonyms:- 2-Hydroxy-3-(1H-imidazol-4-ylmethyl)-benzamide
- 2-Hydroxy-3-[(1H-imidazol-4-yl)methyl]benzamide
- 2-hydroxy-3-(1H-imidazol-5-ylmethyl)benzamide
- Benzamide, 2-hydroxy-3-(1H-imidazol-4-ylmethyl)-
- Benzamide, 2-hydroxy-3-(1H-imidazol-5-ylmethyl)-
- Mivazerol [INN]
- Mivazerolum
- Mivazerolum [INN-Latin]
- Unii-W5P1Ssa8Kd
- alpha-Imidazol-4-yl-2,3-cresotamide
- Mivazerol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Mivazerol
CAS:Mivazerol is a drug that belongs to the class of 2-adrenergic receptor agonists. It has clinical relevance for the treatment of ischemic brain damage, and has been shown to be protective against cerebral infarction in animal models. Mivazerol also has anti-inflammatory effects, inhibiting the production of inflammatory cytokines such as TNF-α and IL-1β. Mivazerol may also help prevent heart failure after abdominal surgery by reducing the risk of developing congestive heart failure due to its ability to lower elevated blood pressure and increase cardiac output. It does this by stimulating the release of catecholamines from sympathetic nerve endings, which increases the rate of cardiac contraction. Mivazerol is a potent inhibitor of phosphodiesterase enzymes and fatty acid synthase, which are involved in regulating intracellular calcium levels. This drug can cause an increase in cytosolic calcium concentrations, which can lead to cell death through activation of apoptosisFormula:C11H11N3O2Purity:Min. 95%Molecular weight:217.22 g/molMivazerol
CAS:Mivazerol is an alpha 2-adrenoceptor agonist.Formula:C11H11N3O2Color and Shape:SolidMolecular weight:217.22



