CymitQuimica logo

CAS 125488-14-4

:

2,4-Dichlorophenacyl thiocyanate

Description:
2,4-Dichlorophenacyl thiocyanate is a chemical compound characterized by its structure, which includes a dichlorophenacyl moiety and a thiocyanate functional group. It is typically a solid at room temperature and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the thiocyanate group. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its dichlorophenyl component contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is also recognized for its potential toxicity, necessitating careful handling and appropriate safety measures during use. As with many thiocyanate derivatives, it may exhibit specific solubility characteristics in organic solvents, which can influence its application in laboratory settings. Overall, 2,4-Dichlorophenacyl thiocyanate is a versatile compound with significant implications in chemical research and development.
Formula:C9H5Cl2NOS
InChI:InChI=1/C9H5Cl2NOS/c10-6-1-2-7(8(11)3-6)9(13)4-14-5-12/h1-3H,4H2
SMILES:c1cc(c(cc1Cl)Cl)C(=O)CSC#N
Synonyms:
  • 2-(2,4-Dichlorophenyl)-2-Oxoethyl Thiocyanate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.