CAS 125488-70-2

4,5-Di-[S-(1-ethoxyethyl)-mercaptoacetamido]-pentanoic acid-2,3,5,6-tetrafluorophenyl ester

Description:

4,5-Di-[S-(1-ethoxyethyl)-mercaptoacetamido]-pentanoic acid-2,3,5,6-tetrafluorophenyl ester, with CAS number 125488-70-2, is a complex organic compound characterized by its multi-functional structure. It features a pentanoic acid backbone, which is modified with two mercaptoacetamido groups, enhancing its reactivity and potential for forming disulfide bonds. The presence of the tetrafluorophenyl ester moiety indicates significant fluorine substitution, which can impart unique electronic properties and increase lipophilicity. This compound may exhibit interesting biological activities due to its ability to interact with various biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the ethoxyethyl groups contribute to its solubility and stability in various solvents. Overall, the intricate structure of this compound suggests potential applications in pharmaceuticals, particularly in the design of targeted therapies or as intermediates in synthetic pathways. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₂₃H₃₂F₄N₂O₆S₂

InChI: InChI=1/C23H32F4N2O6S2/c1-5-33-13(3)36-11-18(30)28-10-15(29-19(31)12-37-14(4)34-6-2)7-8-20(32)35-23-21(26)16(24)9-17(25)22(23)27/h9,13-15H,5-8,10-12H2,1-4H3,(H,28,30)(H,29,31)

SMILES: CCOC(C)SCC(=NCC(CCC(=O)Oc1c(c(cc(c1F)F)F)F)N=C(CSC(C)OCC)O)O

Synonyms:

• 2,3,5,6-Tetrafluorophenyl 4,5-bis-S-(1-ethoxyethyl)mercaptoacetamidopentanoate
• 2,3,5,6-Tetrafluorophenyl 4,5-bis((((1-ethoxyethyl)thio)acetyl)amino)pentanoate
• Tbemp
• Pentanoic acid, 4,5-bis((((1-ethoxyethyl)thio)acetyl)amino)-, 2,3,5,6-tetrafluorophenyl ester
• 2,3,5,6-Tetrafluorophenyl 4,5-Bis({[(1-Ethoxyethyl)Sulfanyl]Acetyl}Amino)Pentanoate