
CAS 1254981-64-0
:Spiro[furo[2,3-b]pyridine-3(2H),4′-piperidine]
Description:
Spiro[furo[2,3-b]pyridine-3(2H),4′-piperidine] is a complex organic compound characterized by its unique spirocyclic structure, which features a fused bicyclic system comprising a furo[2,3-b]pyridine moiety and a piperidine ring. This compound exhibits a combination of heteroatoms, specifically nitrogen and oxygen, contributing to its potential biological activity and chemical reactivity. The presence of the furo[2,3-b]pyridine framework suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the spiro configuration may impart distinctive steric and electronic properties, influencing the compound's solubility, stability, and interaction with other molecules. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, and its properties can be further explored through spectroscopic methods. Overall, Spiro[furo[2,3-b]pyridine-3(2H),4′-piperidine] represents a fascinating subject for research in both synthetic and medicinal chemistry.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c1-2-9-10(13-5-1)14-8-11(9)3-6-12-7-4-11/h1-2,5,12H,3-4,6-8H2
InChI key:InChIKey=OEXJNBBFVSIROY-UHFFFAOYSA-N
SMILES:C12(C=3C(OC1)=NC=CC3)CCNCC2
Synonyms:- Spiro[furo[2,3-b]pyridine-3(2H),4′-piperidine]
- 2H-Spiro[furo[2,3-b]pyridine-3,4′-piperidine]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
