CymitQuimica logo

CAS 1255098-69-1

:

5-(5-Methyl-2-oxazolyl)-2(1H)-pyridinone

Description:
5-(5-Methyl-2-oxazolyl)-2(1H)-pyridinone is a chemical compound characterized by its unique structural features, which include a pyridinone core and an oxazole ring. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the oxazole ring contributes to its stability and may influence its reactivity, while the methyl group enhances its lipophilicity. The compound may also exhibit tautomeric behavior due to the keto-enol equilibrium of the pyridinone moiety, which can affect its chemical properties and interactions. Additionally, it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its potential biological activities. As with many heterocycles, the specific characteristics, such as melting point, boiling point, and spectral properties, would depend on the compound's purity and the conditions under which it is studied. Overall, 5-(5-Methyl-2-oxazolyl)-2(1H)-pyridinone represents a class of compounds of interest in both synthetic and medicinal chemistry.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-6-4-11-9(13-6)7-2-3-8(12)10-5-7/h2-5H,1H3,(H,10,12)
InChI key:InChIKey=JESSGPBZYRMFTM-UHFFFAOYSA-N
SMILES:CC=1OC(C=2C=CC(=O)NC2)=NC1
Synonyms:
  • 5-(5-Methyl-2-oxazolyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 5-(5-methyl-2-oxazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.