
CAS 1255098-83-9
:Cyclohexaneacetic acid, 4-(aminomethyl)-, hydrochloride (1:1), trans-
Description:
Cyclohexaneacetic acid, 4-(aminomethyl)-, hydrochloride (1:1), trans- is a chemical compound characterized by its structural features, which include a cyclohexane ring and an acetic acid moiety with an aminomethyl substituent. This compound is typically encountered as a hydrochloride salt, indicating that it is protonated and exists in a stable ionic form. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it of interest in various chemical and pharmaceutical applications. The trans configuration implies a specific spatial arrangement of substituents around the cyclohexane ring, which can influence its physical and chemical properties, such as solubility and reactivity. As a hydrochloride, it is likely to be more soluble in water compared to its free base form, enhancing its utility in biological systems. Overall, this compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C9H17NO2·ClH
InChI:InChI=1/C9H17NO2.ClH/c10-6-8-3-1-7(2-4-8)5-9(11)12;/h7-8H,1-6,10H2,(H,11,12);1H/t7-,8-;
InChI key:InChIKey=GCQRPHRBRJAQAE-KMMPGQJCNA-N
SMILES:C(C(O)=O)[C@H]1CC[C@H](CN)CC1.Cl
Synonyms:- Cyclohexaneacetic acid, 4-(aminomethyl)-, hydrochloride (1:1), trans-
- trans-(4-Aminomethylcyclohexyl)ethanoic acid hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.