CAS 1255098-86-2

Cyclohexanepropanoic acid, α-(aminomethyl)-α-(cyclohexylmethyl)-, methyl ester, hydrochloride (1:1)

Description:

Cyclohexanepropanoic acid, α-(aminomethyl)-α-(cyclohexylmethyl)-, methyl ester, hydrochloride (1:1), with CAS number 1255098-86-2, is a chemical compound characterized by its complex structure that includes a cyclohexane ring and an amino group. This compound is a hydrochloride salt, indicating that it is a protonated form of the base compound, which enhances its solubility in water and biological fluids. The presence of the methyl ester functional group suggests that it may exhibit ester-like properties, potentially influencing its reactivity and interactions in biological systems. The amino group indicates potential for hydrogen bonding and participation in various biochemical processes. Cyclohexane derivatives often exhibit unique conformational properties due to the rigidity of the cyclohexane ring, which can affect the compound's overall stability and reactivity. This compound may have applications in medicinal chemistry or as a building block in organic synthesis, although specific biological activities or uses would require further investigation.

Formula: C₁₈H₃₃NO₂·ClH

InChI: InChI=1S/C18H33NO2.ClH/c1-21-17(20)18(14-19,12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16;/h15-16H,2-14,19H2,1H3;1H

InChI key: InChIKey=NJDDBUNZSHARRE-UHFFFAOYSA-N

SMILES: C(CC1CCCCC1)(CC2CCCCC2)(C(OC)=O)CN.Cl

Synonyms:

• Cyclohexanepropanoic acid, α-(aminomethyl)-α-(cyclohexylmethyl)-, methyl ester, hydrochloride (1:1)