CAS 1255098-90-8

6-(Methylsulfonyl)-2-phenyl-1H-benzimidazole

Description:

6-(Methylsulfonyl)-2-phenyl-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a methylsulfonyl group and a phenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the methylsulfonyl group may enhance its solubility and stability, while the phenyl group can influence its electronic properties and reactivity. Such compounds are often studied for their pharmacological potential, including anti-inflammatory and anticancer activities. Additionally, the compound's molecular interactions can be explored through various analytical techniques, including spectroscopy and chromatography. Its specific applications and efficacy would depend on further research and testing in relevant biological systems. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.

Formula: C₁₄H₁₂N₂O₂S

InChI: InChI=1S/C14H12N2O2S/c1-19(17,18)11-7-8-12-13(9-11)16-14(15-12)10-5-3-2-4-6-10/h2-9H,1H3,(H,15,16)

InChI key: InChIKey=QRIOGHDSSIVIOT-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C=1C=C2C(N=C(N2)C3=CC=CC=C3)=CC1

Synonyms:

• 6-(Methylsulfonyl)-2-phenyl-1H-benzimidazole
• 1H-Benzimidazole, 6-(methylsulfonyl)-2-phenyl-