CymitQuimica logo

CAS 1255099-04-7

:

Bicyclo[3.2.0]heptan-3-amine

Description:
Bicyclo[3.2.0]heptan-3-amine is a bicyclic organic compound characterized by its unique structure, which consists of a seven-membered ring system with two fused cyclopropane rings. The amine functional group is located at the 3-position of the bicyclic framework, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically colorless to pale yellow and may exhibit a distinct odor. Its molecular structure allows for interesting stereochemical properties, which can influence its interactions with biological systems. Bicyclo[3.2.0]heptan-3-amine may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, its potential as a ligand in coordination chemistry or as a building block in drug development highlights its significance in research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H13N
InChI:InChI=1S/C7H13N/c8-7-3-5-1-2-6(5)4-7/h5-7H,1-4,8H2
InChI key:InChIKey=RCJIJEPMHWIWEU-UHFFFAOYSA-N
SMILES:NC1CC2C(C1)CC2
Synonyms:
  • Bicyclo[3.2.0]heptan-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.