CymitQuimica logo

CAS 1255099-11-6

:

5-(5-Methyl-1,2,4-oxadiazol-3-yl)-2(1H)-pyridinone

Description:
5-(5-Methyl-1,2,4-oxadiazol-3-yl)-2(1H)-pyridinone is a chemical compound characterized by its unique structure, which includes a pyridinone moiety and a 1,2,4-oxadiazole ring. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are often associated with various pharmacological properties. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, although specific biological activities would depend on further empirical studies. The methyl group on the oxadiazole ring can influence the compound's solubility and reactivity. Additionally, the compound's molecular structure suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 1255099-11-6, allows for easy identification and retrieval of information related to its synthesis, properties, and applications in scientific literature. Overall, this compound represents a class of heterocyclic compounds that may have significant implications in drug development and other chemical applications.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-5-10-8(11-13-5)6-2-3-7(12)9-4-6/h2-4H,1H3,(H,9,12)
InChI key:InChIKey=ZFNKREYFGWCHFS-UHFFFAOYSA-N
SMILES:CC1=NC(C=2C=CC(=O)NC2)=NO1
Synonyms:
  • 2(1H)-Pyridinone, 5-(5-methyl-1,2,4-oxadiazol-3-yl)-
  • 5-(5-Methyl-1,2,4-oxadiazol-3-yl)-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.