CymitQuimica logo

CAS 1255099-19-4

:

4a,5,6,7,8,8a-Hexahydro-2-(trifluoromethyl)-6-quinolinecarboxylic acid

Description:
4a,5,6,7,8,8a-Hexahydro-2-(trifluoromethyl)-6-quinolinecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a quinoline moiety. This compound features a trifluoromethyl group, which significantly influences its chemical reactivity and biological activity due to the electronegative fluorine atoms. The hexahydro component indicates that the compound is saturated, contributing to its stability and solubility in various solvents. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its interactions with biological systems. This compound may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, the trifluoromethyl group is often associated with increased lipophilicity, which can affect the compound's pharmacokinetics and bioavailability. Overall, the combination of these structural elements makes it a compound of interest in various chemical and biological research fields.
Formula:C11H12F3NO2
InChI:InChI=1S/C11H12F3NO2/c12-11(13,14)9-4-2-6-5-7(10(16)17)1-3-8(6)15-9/h2,4,6-8H,1,3,5H2,(H,16,17)
InChI key:InChIKey=LXWYEMNRKSKQNR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC2C(CC(C(O)=O)CC2)C=C1
Synonyms:
  • 4a,5,6,7,8,8a-Hexahydro-2-(trifluoromethyl)-6-quinolinecarboxylic acid
  • 6-Quinolinecarboxylic acid, 4a,5,6,7,8,8a-hexahydro-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.