CAS 1255099-24-1

3-(2-Chloro-4-pyridinyl)-1,2,4-oxadiazole-5-propanoic acid

Description:

3-(2-Chloro-4-pyridinyl)-1,2,4-oxadiazole-5-propanoic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and an oxadiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in various solvents. The presence of the oxadiazole ring suggests it may have applications in pharmaceuticals or agrochemicals, as oxadiazoles are known for their antimicrobial and anti-inflammatory properties. The propanoic acid functional group indicates that it may also exhibit acidic behavior, influencing its reactivity and interactions with other molecules. Additionally, the chlorine substitution on the pyridine ring can enhance lipophilicity and alter the compound's pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and material science, although specific applications would depend on further research and testing.

Formula: C₁₀H₈ClN₃O₃

InChI: InChI=1S/C10H8ClN3O3/c11-7-5-6(3-4-12-7)10-13-8(17-14-10)1-2-9(15)16/h3-5H,1-2H2,(H,15,16)

InChI key: InChIKey=LWOWHSWJHZRMGT-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=NC(=NO1)C=2C=C(Cl)N=CC2

Synonyms:

• 3-(2-Chloro-4-pyridinyl)-1,2,4-oxadiazole-5-propanoic acid
• 1,2,4-Oxadiazole-5-propanoic acid, 3-(2-chloro-4-pyridinyl)-