CAS 1255099-27-4

Benzothiazole, 2-(3-azetidinyl)-, hydrochloride (1:1)

Description:

Benzothiazole, 2-(3-azetidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and an azetidine ring. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. This compound may exhibit biological activity due to the functional groups present, potentially influencing its interaction with biological systems. The benzothiazole structure is known for its role in medicinal chemistry, often associated with antimicrobial, anti-inflammatory, and anticancer properties. The azetidine ring contributes to the compound's overall reactivity and may affect its pharmacokinetic properties. As with many chemical substances, safety data and handling precautions are essential, as the compound may pose risks if not managed properly. Overall, Benzothiazole, 2-(3-azetidinyl)-, hydrochloride (1:1) represents a class of compounds that could be of interest in drug development and research.

Formula: C₁₀H₁₀N₂S·ClH

InChI: InChI=1S/C10H10N2S.ClH/c1-2-4-9-8(3-1)12-10(13-9)7-5-11-6-7;/h1-4,7,11H,5-6H2;1H

InChI key: InChIKey=GKLABRRWFPRIEW-UHFFFAOYSA-N

SMILES: C1(=NC=2C(S1)=CC=CC2)C3CNC3.Cl

Synonyms:

• Benzothiazole, 2-(3-azetidinyl)-, hydrochloride (1:1)

2-(Azetidin-3-yl)benzo[d]thiazole hydrochloride

CAS: 1255099-27-4

Formula: C₁₀H₁₁ClN₂S

Molecular weight: 226.7257

Ref: IN-DA000NSQ

2-(AZETIDIN-3-YL)BENZO[D]THIAZOLE HCL

CAS: 1255099-27-4

Purity: 97.0%

Molecular weight: 226.72000122070312

Ref: 10-F301104