CymitQuimica logo

CAS 1255099-30-9

:

3-Amino-8-bromo-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid

Description:
3-Amino-8-bromo-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a benzopyran moiety, an amino group, and a carboxylic acid functional group. The presence of the bromine atom at the 8-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is likely to exhibit both acidic and basic properties due to the carboxylic acid and amino groups, respectively, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its dihydrobenzopyran structure suggests potential biological activity, making it a candidate for further investigation in drug development. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are crucial for its application in synthesis and biological assays. Overall, 3-Amino-8-bromo-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid represents a versatile scaffold in organic synthesis and pharmaceutical research.
Formula:C10H10BrNO3
InChI:InChI=1S/C10H10BrNO3/c11-7-3-1-2-6-4-10(12,9(13)14)5-15-8(6)7/h1-3H,4-5,12H2,(H,13,14)
InChI key:InChIKey=RIHADWCFSZNKJA-UHFFFAOYSA-N
SMILES:BrC1=C2C(CC(C(O)=O)(N)CO2)=CC=C1
Synonyms:
  • 2H-1-Benzopyran-3-carboxylic acid, 3-amino-8-bromo-3,4-dihydro-
  • 3-Amino-8-bromo-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.