
CAS 1255099-32-1
:4,5,6,7-Tetrahydro-4-(2-pyridinyl)thieno[3,2-c]pyridine
Description:
4,5,6,7-Tetrahydro-4-(2-pyridinyl)thieno[3,2-c]pyridine is a heterocyclic compound characterized by its complex bicyclic structure, which includes both a thieno and pyridine moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and potential biological activity. The presence of the pyridine ring suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including coordination with metal ions or interaction with biological targets. The thieno[3,2-c]pyridine framework is known for its potential pharmacological applications, particularly in medicinal chemistry, where such compounds may serve as scaffolds for drug development. Additionally, the compound's unique structure may influence its solubility, lipophilicity, and overall reactivity, making it of interest in both synthetic and applied chemistry contexts. Overall, 4,5,6,7-Tetrahydro-4-(2-pyridinyl)thieno[3,2-c]pyridine represents a significant class of compounds with diverse applications in research and industry.
Formula:C12H12N2S
InChI:InChI=1S/C12H12N2S/c1-2-6-13-10(3-1)12-9-5-8-15-11(9)4-7-14-12/h1-3,5-6,8,12,14H,4,7H2
InChI key:InChIKey=NBFMBZPUSOIWQS-UHFFFAOYSA-N
SMILES:C=12C(NCCC1SC=C2)C3=CC=CC=N3
Synonyms:- Thieno[3,2-c]pyridine, 4,5,6,7-tetrahydro-4-(2-pyridinyl)-
- 2-[4H,5H,6H,7H-Thieno[3,2-c]pyridin-4-yl]pyridine
- 4,5,6,7-Tetrahydro-4-(2-pyridinyl)thieno[3,2-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.