CymitQuimica logo

CAS 1255099-35-4

:

Phenylmethyl 3-(5-bromo-1,3,4-thiadiazol-2-yl)-1-piperidinecarboxylate

Description:
Phenylmethyl 3-(5-bromo-1,3,4-thiadiazol-2-yl)-1-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylate group, and a thiadiazole moiety. The presence of the bromine atom in the thiadiazole ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic heterocyclic compound due to the inclusion of nitrogen and sulfur in its structure. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The piperidine ring can influence the compound's ability to interact with biological targets, while the carboxylate group may enhance solubility and stability. Additionally, the bromine substituent can affect the compound's electronic properties and steric hindrance, which are crucial for its interaction with enzymes or receptors. Overall, this compound's unique structural features suggest potential applications in drug development and research within the field of organic chemistry.
Formula:C15H16BrN3O2S
InChI:InChI=1S/C15H16BrN3O2S/c16-14-18-17-13(22-14)12-7-4-8-19(9-12)15(20)21-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2
InChI key:InChIKey=LVBUADBLVOECRC-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC(CCC2)C=3SC(Br)=NN3
Synonyms:
  • 1-Piperidinecarboxylic acid, 3-(5-bromo-1,3,4-thiadiazol-2-yl)-, phenylmethyl ester
  • Phenylmethyl 3-(5-bromo-1,3,4-thiadiazol-2-yl)-1-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.