CymitQuimica logo

CAS 1255099-41-2

:

Spiro[3.3]heptan-2-amine

Description:
Spiro[3.3]heptan-2-amine is a bicyclic organic compound characterized by its unique spiro structure, which consists of two interconnected rings sharing a single atom. This compound features an amine functional group, specifically a primary amine, located at the second carbon of the spiro system. The spiro configuration contributes to its three-dimensional shape, influencing its chemical reactivity and potential applications. Typically, compounds like spiro[3.3]heptan-2-amine exhibit interesting stereochemical properties, which can affect their interactions in biological systems. The presence of the amine group suggests potential for hydrogen bonding and reactivity with electrophiles. Additionally, the rigidity of the spiro framework may impart stability to the molecule, making it a candidate for various synthetic applications in organic chemistry and medicinal chemistry. Overall, spiro[3.3]heptan-2-amine represents a fascinating example of spirocyclic compounds, with implications in the development of pharmaceuticals and other chemical products.
Formula:C7H13N
InChI:InChI=1S/C7H13N/c8-6-4-7(5-6)2-1-3-7/h6H,1-5,8H2
InChI key:InChIKey=LGPCTMRNPRKHPR-UHFFFAOYSA-N
SMILES:NC1CC2(C1)CCC2
Synonyms:
  • Spiro[3.3]heptan-2-amine
  • Spiro[3,3]hept-2-ylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.