CymitQuimica logo

CAS 1255099-58-1

:

α-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-4-fluorobenzenepropanoic acid

Description:
α-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-4-fluorobenzenepropanoic acid, identified by its CAS number 1255099-58-1, is a chemical compound characterized by its complex structure, which includes a fluorobenzene moiety and an amino acid derivative. This compound features a propanoic acid backbone, which contributes to its acidic properties, while the presence of a dimethylethoxycarbonyl group enhances its stability and solubility in organic solvents. The fluorine atom in the para position of the benzene ring can influence the compound's electronic properties and reactivity, making it potentially useful in medicinal chemistry and drug design. Additionally, the amino group allows for potential interactions with biological targets, suggesting applications in pharmaceuticals. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, including protection-deprotection strategies and coupling reactions. Overall, this compound exemplifies the intricate design often found in bioactive molecules, combining functional groups that may impart specific biological activities or enhance pharmacokinetic properties.
Formula:C15H20FNO4
InChI:InChI=1S/C15H20FNO4/c1-15(2,3)21-14(20)17-9-11(13(18)19)8-10-4-6-12(16)7-5-10/h4-7,11H,8-9H2,1-3H3,(H,17,20)(H,18,19)
InChI key:InChIKey=CVADAENURLNNQZ-UHFFFAOYSA-N
SMILES:C(C(CNC(OC(C)(C)C)=O)C(O)=O)C1=CC=C(F)C=C1
Synonyms:
  • Benzenepropanoic acid, α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-fluoro-
  • 2-[(tert-Butoxycarbonylamino)methyl]-3-(4-fluorophenyl)propanoic acid
  • α-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-4-fluorobenzenepropanoic acid
  • 3-[[(tert-Butoxy)carbonyl]amino]-2-[(4-fluorophenyl)methyl]propanoic acid
  • 2-(n-Boc-aminomethyl)-3-(4-fluorophenyl)propionic acid
Found 4 products.