
CAS 1255099-59-2
:Piperazine, 1-(4-chloro-2-pyridinyl)-, hydrochloride (1:3)
Description:
Piperazine, 1-(4-chloro-2-pyridinyl)-, hydrochloride (1:3) is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 4-chloro-2-pyridinyl substituent indicates that it has a pyridine ring with a chlorine atom at the para position relative to the nitrogen atom. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The compound's structure suggests it may exhibit properties such as antimicrobial or anti-parasitic activity, although specific biological activities would depend on further empirical studies. As with many piperazine derivatives, it may also have implications in the field of neuropharmacology. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H12ClN3·3ClH
InChI:InChI=1S/C9H12ClN3.3ClH/c10-8-1-2-12-9(7-8)13-5-3-11-4-6-13;;;/h1-2,7,11H,3-6H2;3*1H
InChI key:InChIKey=ITNREXFPUMTNEV-UHFFFAOYSA-N
SMILES:ClC=1C=C(N=CC1)N2CCNCC2.Cl
Synonyms:- Piperazine, 1-(4-chloro-2-pyridinyl)-, hydrochloride (1:3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.