
CAS 1255099-68-3
:7-Isoquinolinamine, 5,8-dichloro-1,2,3,4,4a,8a-hexahydro-, hydrochloride (1:2)
Description:
7-Isoquinolinamine, 5,8-dichloro-1,2,3,4,4a,8a-hexahydro-, hydrochloride (1:2) is a chemical compound characterized by its complex bicyclic structure, which includes an isoquinoline moiety. The presence of dichloro substituents at the 5 and 8 positions contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical contexts. The hexahydro configuration indicates that the compound is saturated, which may influence its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific interactions and mechanisms of action would require further investigation through experimental studies. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity. Overall, this compound represents a class of heterocyclic amines that may have significant implications in drug development and therapeutic applications.
Formula:C9H12Cl2N2·2ClH
InChI:InChI=1S/C9H12Cl2N2.2ClH/c10-7-3-8(12)9(11)6-4-13-2-1-5(6)7;;/h3,5-6,13H,1-2,4,12H2;2*1H
InChI key:InChIKey=RZGUUNXIBSFIAR-UHFFFAOYSA-N
SMILES:ClC=1C2C(C(Cl)=CC1N)CCNC2.Cl
Synonyms:- 7-Isoquinolinamine, 5,8-dichloro-1,2,3,4,4a,8a-hexahydro-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.