CAS 1255146-89-4

2,3,5,6-Tetrahydroimidazo[2,1-b]thiazole-6-propanoic acid

Description:

2,3,5,6-Tetrahydroimidazo[2,1-b]thiazole-6-propanoic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound features a propanoic acid functional group, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Its synthesis often involves multi-step organic reactions, and it may serve as a building block for more complex molecules. The presence of nitrogen and sulfur in its structure can influence its reactivity and interaction with biological targets. As with many heterocycles, it may exhibit unique electronic properties, which can be leveraged in various applications, including drug design and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₁₂N₂O₂S

InChI: InChI=1S/C8H12N2O2S/c11-7(12)2-1-6-5-10-3-4-13-8(10)9-6/h6H,1-5H2,(H,11,12)

InChI key: InChIKey=QKWSEWAHYIEGGG-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1N=C2N(C1)CCS2

Synonyms:

• Imidazo[2,1-b]thiazole-6-propanoic acid, 2,3,5,6-tetrahydro-
• 2,3,5,6-Tetrahydroimidazo[2,1-b]thiazole-6-propanoic acid