CymitQuimica logo

CAS 1255146-98-5

:

5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid hydrazide

Description:
5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid hydrazide is a chemical compound characterized by its unique triazole and pyridine ring structures, which contribute to its potential biological activity. This compound features a hydrazide functional group, which is known for its reactivity and ability to form various derivatives. The presence of methyl groups at the 5 and 7 positions of the triazole ring enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The carboxylic acid moiety may impart acidity and facilitate interactions with biological targets, making it of interest in medicinal chemistry. The compound's CAS number, 1255146-98-5, allows for easy identification in chemical databases. While specific applications and biological activities may vary, compounds of this type are often investigated for their potential as pharmaceuticals, particularly in areas such as anti-inflammatory or antimicrobial research. Further studies would be necessary to elucidate its full range of properties and potential uses in various fields.
Formula:C9H11N5O
InChI:InChI=1S/C9H11N5O/c1-5-3-6(2)14-7(4-5)11-8(13-14)9(15)12-10/h3-4H,10H2,1-2H3,(H,12,15)
InChI key:InChIKey=HHPBRLMLJWPRHK-UHFFFAOYSA-N
SMILES:CC=1N2C(=NC(C(NN)=O)=N2)C=C(C)C1
Synonyms:
  • 5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid hydrazide
  • [1,2,4]Triazolo[1,5-a]pyridine-2-carboxylic acid, 5,7-dimethyl-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.