CAS 1255147-01-3
:4-(2-Ethoxyphenoxy)-2-quinolinecarboxylic acid
Description:
4-(2-Ethoxyphenoxy)-2-quinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline ring system and an ethoxyphenyl moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, contributing to its potential solubility in organic solvents and moderate solubility in water. The presence of the ethoxy group enhances its lipophilicity, which may influence its biological activity and interaction with cellular membranes. The quinoline core is known for its diverse pharmacological properties, including antimicrobial and anticancer activities. As a carboxylic acid, it can participate in acid-base reactions and form salts or esters. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, its unique combination of functional groups may allow for further derivatization, expanding its utility in various chemical syntheses and applications in research.
Formula:C18H15NO4
InChI:InChI=1S/C18H15NO4/c1-2-22-15-9-5-6-10-16(15)23-17-11-14(18(20)21)19-13-8-4-3-7-12(13)17/h3-11H,2H2,1H3,(H,20,21)
InChI key:InChIKey=IGQNPFHSPBVLAF-UHFFFAOYSA-N
SMILES:O(C=1C2=C(N=C(C(O)=O)C1)C=CC=C2)C3=C(OCC)C=CC=C3
Synonyms:- 2-Quinolinecarboxylic acid, 4-(2-ethoxyphenoxy)-
- 4-(2-Ethoxyphenoxy)-2-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.