CAS 1255147-11-5
:1-(2,2-Diethoxyethyl)-4-ethyl-3,5-dimethyl-1H-pyrazole
Description:
1-(2,2-Diethoxyethyl)-4-ethyl-3,5-dimethyl-1H-pyrazole is a chemical compound characterized by its unique pyrazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features a diethoxyethyl group, contributing to its solubility and reactivity, as well as an ethyl group and two methyl groups that enhance its hydrophobic characteristics. The presence of these substituents can influence its physical properties, such as boiling and melting points, as well as its chemical reactivity, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its exact mechanisms and potential uses. Additionally, its CAS number, 1255147-11-5, allows for easy identification and reference in chemical databases, facilitating research and development efforts related to this compound. Overall, this substance represents a complex organic molecule with potential significance in various fields of chemistry and material science.
Formula:C13H24N2O2
InChI:InChI=1S/C13H24N2O2/c1-6-12-10(4)14-15(11(12)5)9-13(16-7-2)17-8-3/h13H,6-9H2,1-5H3
InChI key:InChIKey=FPFZYYLOMPTRIM-UHFFFAOYSA-N
SMILES:C(C(OCC)OCC)N1C(C)=C(CC)C(C)=N1
Synonyms:- 1-(2,2-Diethoxyethyl)-4-ethyl-3,5-dimethyl-1H-pyrazole
- 1H-Pyrazole, 1-(2,2-diethoxyethyl)-4-ethyl-3,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.