CymitQuimica logo

CAS 1255147-15-9

:

2-(Chloromethyl)-N-(2-methoxyethyl)-4-quinazolinamine

Description:
2-(Chloromethyl)-N-(2-methoxyethyl)-4-quinazolinamine is a chemical compound characterized by its quinazolinamine core, which is a bicyclic structure containing both a benzene and a pyrimidine ring. The presence of a chloromethyl group indicates that it has a chlorine atom attached to a methylene group, which can enhance its reactivity, particularly in nucleophilic substitution reactions. The N-(2-methoxyethyl) substituent suggests that the compound has an ether functional group, contributing to its solubility and potential interactions with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly for its potential as a pharmaceutical agent. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Safety and handling precautions should be observed due to the presence of the chloromethyl group, which can be hazardous. Overall, this compound represents a unique structure with potential applications in drug development and research.
Formula:C12H14ClN3O
InChI:InChI=1S/C12H14ClN3O/c1-17-7-6-14-12-9-4-2-3-5-10(9)15-11(8-13)16-12/h2-5H,6-8H2,1H3,(H,14,15,16)
InChI key:InChIKey=ORQYDFRXJHRJNM-UHFFFAOYSA-N
SMILES:N(CCOC)C=1C2=C(N=C(CCl)N1)C=CC=C2
Synonyms:
  • 2-(Chloromethyl)-N-(2-methoxyethyl)-4-quinazolinamine
  • 4-Quinazolinamine, 2-(chloromethyl)-N-(2-methoxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.