CAS 1255147-16-0
:α-Ethylimidazo[1,2-a]pyridine-2-methanamine
Description:
α-Ethylimidazo[1,2-a]pyridine-2-methanamine is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures, which contribute to its unique chemical properties. This compound features an ethyl group and a methanamine functional group, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as heterocycles are often key components in drug design. Additionally, its specific arrangement of nitrogen atoms within the rings may impart interesting electronic properties, making it a candidate for further research in various chemical and biological contexts. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c1-2-8(11)9-7-13-6-4-3-5-10(13)12-9/h3-8H,2,11H2,1H3
InChI key:InChIKey=DSFAHIHQWKUINJ-UHFFFAOYSA-N
SMILES:C(CC)(N)C=1N=C2N(C1)C=CC=C2
Synonyms:- Imidazo[1,2-a]pyridine-2-methanamine, α-ethyl-
- α-Ethylimidazo[1,2-a]pyridine-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.