CAS 1255147-17-1
:N-[2-(4-Morpholinylsulfonyl)ethyl]-3-pyridinemethanamine
Description:
N-[2-(4-Morpholinylsulfonyl)ethyl]-3-pyridinemethanamine, with the CAS number 1255147-17-1, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a morpholine moiety. This compound typically exhibits properties associated with both amines and sulfonamides, suggesting potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the morpholine group may impart solubility in polar solvents, while the pyridine ring can contribute to its ability to interact with biological targets. Additionally, the sulfonyl group enhances the compound's reactivity and may influence its pharmacokinetic properties. As with many compounds containing nitrogen and sulfur, it may exhibit basicity and can participate in hydrogen bonding, which is crucial for its biological activity. Overall, this compound's unique structural features suggest it could be of interest in drug discovery and development, particularly in targeting specific biological pathways or receptors.
Formula:C12H19N3O3S
InChI:InChI=1S/C12H19N3O3S/c16-19(17,15-5-7-18-8-6-15)9-4-14-11-12-2-1-3-13-10-12/h1-3,10,14H,4-9,11H2
InChI key:InChIKey=BCWVRPQACSURIR-UHFFFAOYSA-N
SMILES:S(CCNCC=1C=CC=NC1)(=O)(=O)N2CCOCC2
Synonyms:- 3-Pyridinemethanamine, N-[2-(4-morpholinylsulfonyl)ethyl]-
- N-[2-(4-Morpholinylsulfonyl)ethyl]-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.