
CAS 1255147-19-3
:5-Amino-1,3,4-oxadiazole-2-carboximidamide
Description:
5-Amino-1,3,4-oxadiazole-2-carboximidamide is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. This compound features an amino group and a carboximidamide functional group, contributing to its potential reactivity and biological activity. The oxadiazole moiety is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the amino group enhances its solubility in polar solvents, while the carboximidamide group may participate in hydrogen bonding, influencing its interactions in biological systems. This compound may exhibit antimicrobial or antitumor properties, making it of interest in drug discovery. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is studied. As with many heterocycles, the electronic properties of the ring can also play a significant role in its reactivity and potential applications.
Formula:C3H5N5O
InChI:InChI=1S/C3H5N5O/c4-1(5)2-7-8-3(6)9-2/h(H3,4,5)(H2,6,8)
InChI key:InChIKey=IVMIZMPGFHHODC-UHFFFAOYSA-N
SMILES:C(=N)(N)C=1OC(N)=NN1
Synonyms:- 5-Amino-1,3,4-oxadiazole-2-carboximidamide
- 1,3,4-Oxadiazole-2-carboximidamide, 5-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.