CAS 1255147-24-0
:5-Chloro-2-(4-cyano-2-methoxyphenoxy)-3-pyridinecarboxylic acid
Description:
5-Chloro-2-(4-cyano-2-methoxyphenoxy)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and various substituents that contribute to its chemical properties. The presence of a chloro group and a cyano group indicates potential reactivity and polarity, while the methoxy group enhances solubility in organic solvents. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the functional groups present. It may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in synthetic organic chemistry. Additionally, the compound's unique structure may confer specific biological activities, which could be explored in pharmaceutical research. Overall, its characteristics suggest potential applications in medicinal chemistry and material science, although specific properties such as melting point, solubility, and spectral data would require empirical determination for precise applications.
Formula:C14H9ClN2O4
InChI:InChI=1S/C14H9ClN2O4/c1-20-12-4-8(6-16)2-3-11(12)21-13-10(14(18)19)5-9(15)7-17-13/h2-5,7H,1H3,(H,18,19)
InChI key:InChIKey=XPORMAZMHQWFRF-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=C(C#N)C=C1)C2=C(C(O)=O)C=C(Cl)C=N2
Synonyms:- 3-Pyridinecarboxylic acid, 5-chloro-2-(4-cyano-2-methoxyphenoxy)-
- 5-Chloro-2-(4-cyano-2-methoxyphenoxy)-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.