CAS 1255147-25-1

Ethyl N-[2-(2-imino-3(2H)-thiazolyl)acetyl]carbamate

Description:

Ethyl N-[2-(2-imino-3(2H)-thiazolyl)acetyl]carbamate is a chemical compound characterized by its unique structural features, which include a thiazole ring and a carbamate functional group. This compound typically exhibits properties associated with both thiazole derivatives and carbamates, such as potential biological activity and solubility in organic solvents. The thiazole moiety may contribute to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry and drug development. The presence of the ethyl group enhances its lipophilicity, potentially influencing its absorption and distribution in biological systems. Additionally, the imino group may impart specific reactivity, allowing for further chemical modifications. Overall, this compound's characteristics suggest it could be explored for applications in pharmaceuticals, particularly in the development of agents with antimicrobial or anticancer properties. However, detailed studies would be necessary to fully elucidate its biological activity and potential applications.

Formula: C₈H₁₁N₃O₃S

InChI: InChI=1S/C8H11N3O3S/c1-2-14-8(13)10-6(12)5-11-3-4-15-7(11)9/h3-4,9H,2,5H2,1H3,(H,10,12,13)

InChI key: InChIKey=YVLFYAVIECHDGV-UHFFFAOYSA-N

SMILES: C(C(NC(OCC)=O)=O)N1C(=N)SC=C1

Synonyms:

• Carbamic acid, N-[2-(2-imino-3(2H)-thiazolyl)acetyl]-, ethyl ester
• Ethyl N-[2-(2-imino-3(2H)-thiazolyl)acetyl]carbamate
• Ethyl [(2-imino-1,3-thiazol-3(2H)-yl)acetyl]carbamate