CAS 1255147-29-5

7-Methylimidazo[1,2-a]pyrimidine-2-propanoic acid

Description:

7-Methylimidazo[1,2-a]pyrimidine-2-propanoic acid is a heterocyclic compound characterized by its fused imidazole and pyrimidine rings, along with a propanoic acid side chain. This compound is part of a class of substances known for their potential biological activity, particularly in relation to mutagenicity and carcinogenicity. The presence of the methyl group at the 7-position of the imidazo ring can influence its chemical reactivity and biological interactions. The propanoic acid moiety contributes to its solubility and potential interactions with biological systems. This compound may be of interest in pharmaceutical research, particularly in the study of metabolic pathways and the development of therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular structure and the environment in which it is studied. As with many heterocyclic compounds, understanding its behavior in biological systems is crucial for assessing its safety and efficacy in potential applications.

Formula: C₁₀H₁₁N₃O₂

InChI: InChI=1S/C10H11N3O2/c1-7-4-5-13-6-8(2-3-9(14)15)12-10(13)11-7/h4-6H,2-3H2,1H3,(H,14,15)

InChI key: InChIKey=UCNAZGDAZBMRNL-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=CN2C(=N1)N=C(C)C=C2

Synonyms:

• 7-Methylimidazo[1,2-a]pyrimidine-2-propanoic acid
• Imidazo[1,2-a]pyrimidine-2-propanoic acid, 7-methyl-