CymitQuimica logo

CAS 1255147-31-9

:

5-Chloro-2-[(2-methyl-3-pyridinyl)oxy]-3-pyridinecarboxylic acid

Description:
5-Chloro-2-[(2-methyl-3-pyridinyl)oxy]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of chlorine and a methoxy group contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the pyridine rings may influence its interaction with biological targets. The chlorine substituent can enhance the compound's lipophilicity, potentially affecting its bioavailability and pharmacokinetics. Additionally, the presence of multiple heteroatoms in the structure may impart specific electronic properties, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use. Overall, 5-Chloro-2-[(2-methyl-3-pyridinyl)oxy]-3-pyridinecarboxylic acid represents a valuable compound for exploration in various chemical and biological applications.
Formula:C12H9ClN2O3
InChI:InChI=1S/C12H9ClN2O3/c1-7-10(3-2-4-14-7)18-11-9(12(16)17)5-8(13)6-15-11/h2-6H,1H3,(H,16,17)
InChI key:InChIKey=UKIFTEMYMAVDFQ-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)C=C(Cl)C=N1)C2=C(C)N=CC=C2
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-chloro-2-[(2-methyl-3-pyridinyl)oxy]-
  • 5-Chloro-2-[(2-methyl-3-pyridinyl)oxy]-3-pyridinecarboxylic acid
Found 2 products.