CAS 1255147-34-2
:3-Chloro-1-methyl-1H-pyrazole-4-carboxylic acid hydrazide
Description:
3-Chloro-1-methyl-1H-pyrazole-4-carboxylic acid hydrazide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound features a chloro substituent at the 3-position and a methyl group at the 1-position of the pyrazole ring, contributing to its unique reactivity and properties. The presence of the carboxylic acid hydrazide functional group enhances its potential for forming hydrogen bonds, making it a candidate for various biological activities. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its reactivity can be influenced by the electron-withdrawing nature of the chloro group and the hydrazide moiety, which may participate in further chemical transformations. As with many pyrazole derivatives, it may exhibit interesting pharmacological properties, warranting further investigation in medicinal chemistry.
Formula:C5H7ClN4O
InChI:InChI=1S/C5H7ClN4O/c1-10-2-3(4(6)9-10)5(11)8-7/h2H,7H2,1H3,(H,8,11)
InChI key:InChIKey=IBBJIYFPZOBAQA-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CN(C)N=C1Cl
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 3-chloro-1-methyl-, hydrazide
- 3-Chloro-1-methyl-1H-pyrazole-4-carboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.