CAS 1255147-36-4
:3-Pyridinecarbonitrile, 2-(cyanoamino)-
Description:
3-Pyridinecarbonitrile, 2-(cyanoamino)- is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-C≡N) and an amino group (-NH2) attached to the carbon chain, contributing to its reactivity and potential applications in organic synthesis. The presence of both cyano and amino functionalities suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit polar characteristics due to the functional groups present. As with many nitrogen-containing heterocycles, it may also display interesting properties such as solubility in polar solvents and potential for hydrogen bonding. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H4N4
InChI:InChI=1S/C7H4N4/c8-4-6-2-1-3-10-7(6)11-5-9/h1-3H,(H,10,11)
InChI key:InChIKey=NPZFPDRFXDVSFJ-UHFFFAOYSA-N
SMILES:N(C#N)C1=C(C#N)C=CC=N1
Synonyms:- 3-Pyridinecarbonitrile, 2-(cyanoamino)-
- (3-Cyano-2-pyridinyl)cyanamide
- Cyanamide N-(3-cyano-2-pyridinyl)-
- (3-Cyanopyridin-2-yl)cyanamide
- N-(3-Cyano-2-pyridyl)cyanamide
- N-(3-cyanopyridin-2-yl)cyanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.