CAS 1255147-46-6

Ethyl 3-ethyl-1,2,4-triazolo[4,3-a]pyridine-5-carboxylate

Description:

Ethyl 3-ethyl-1,2,4-triazolo[4,3-a]pyridine-5-carboxylate is a chemical compound characterized by its unique triazole and pyridine ring structure, which contributes to its potential biological activity. This compound features an ethyl ester functional group, enhancing its solubility in organic solvents and possibly influencing its pharmacokinetic properties. The presence of the triazole ring suggests potential applications in medicinal chemistry, as triazoles are known for their role in various therapeutic agents, including antifungal and anticancer drugs. The compound's molecular structure may also exhibit specific reactivity patterns, making it of interest in synthetic organic chemistry. Additionally, its CAS number, 1255147-46-6, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in research and industry. Overall, this compound represents a fascinating area of study within the field of heterocyclic chemistry, with implications for drug development and material science.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1S/C11H13N3O2/c1-3-9-12-13-10-7-5-6-8(14(9)10)11(15)16-4-2/h5-7H,3-4H2,1-2H3

InChI key: InChIKey=SCLPXVXYFUUENB-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N2C(=NN=C2CC)C=CC1

Synonyms:

• 1,2,4-Triazolo[4,3-a]pyridine-5-carboxylic acid, 3-ethyl-, ethyl ester
• Ethyl 3-ethyl-1,2,4-triazolo[4,3-a]pyridine-5-carboxylate